About N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-3-(2-oxochromen-3-yl)benzamide
N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-3-(2-oxochromen-3-yl)benzamide (PubChem CID 171912909) has the molecular formula C22H23NO4
and a molecular weight of 365.43 g/mol. Its IUPAC name is N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-3-(2-oxochromen-3-yl)benzamide.
Molecular Properties
| Compound Name | N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-3-(2-oxochromen-3-yl)benzamide |
| PubChem CID | 171912909 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-3-(2-oxochromen-3-yl)benzamide |
| SMILES | CN(CC(C)(C)CO)C(=O)c1cccc(-c2cc3ccccc3oc2=O)c1 |
| InChI | InChI=1S/C22H23NO4/c1-22(2,14-24)13-23(3)20(25)17-9-6-8-15(11-17)18-12-16-7-4-5-10-19(16)27-21(18)26/h4-12,24H,13-14H2,1-3H3 |
| InChIKey | UHLMPWXHKUYICX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|
Analyze N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-3-(2-oxochromen-3-yl)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-3-(2-oxochromen-3-yl)benzamide?
The IUPAC name of N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-3-(2-oxochromen-3-yl)benzamide (CID 171912909) is N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-3-(2-oxochromen-3-yl)benzamide.
What is the SMILES notation for N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-3-(2-oxochromen-3-yl)benzamide?
The canonical SMILES for N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-3-(2-oxochromen-3-yl)benzamide is CN(CC(C)(C)CO)C(=O)c1cccc(-c2cc3ccccc3oc2=O)c1.
What is the InChIKey of N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-3-(2-oxochromen-3-yl)benzamide?
The InChIKey is UHLMPWXHKUYICX-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H23NO4/c1-22(2,14-24)13-23(3)20(25)17-9-6-8-15(11-17)18-12-16-7-4-5-10-19(16)27-21(18)26/h4-12,24H,13-14H2,1-3H3.
What are the key properties of N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-3-(2-oxochromen-3-yl)benzamide?
N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-3-(2-oxochromen-3-yl)benzamide has a molecular weight of 365.43 g/mol, XLogP of 3.55, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-3-(2-oxochromen-3-yl)benzamide is sourced from PubChem (CID 171912909), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).