C22H23NO4 — CID 171912909
N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-3-(2-oxochromen-3-yl)benzamide (PubChem CID 171912909) has the molecular formula C22H23NO4 and a molecular weight of 365.43 g/mol. Its IUPAC name is N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-3-(2-oxochromen-3-yl)benzamide.
| Compound Name | N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-3-(2-oxochromen-3-yl)benzamide |
|---|---|
| PubChem CID | 171912909 |
| Molecular Formula | C22H23NO4 |
| Molecular Weight | 365.43 g/mol |
| Exact Mass | 365.16 |
| IUPAC Name | N-(3-hydroxy-2,2-dimethylpropyl)-N-methyl-3-(2-oxochromen-3-yl)benzamide |
| SMILES | CN(CC(C)(C)CO)C(=O)c1cccc(-c2cc3ccccc3oc2=O)c1 |
| InChI | InChI=1S/C22H23NO4/c1-22(2,14-24)13-23(3)20(25)17-9-6-8-15(11-17)18-12-16-7-4-5-10-19(16)27-21(18)26/h4-12,24H,13-14H2,1-3H3 |
| InChIKey | UHLMPWXHKUYICX-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.43 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|