C20H16F3NO4 — CID 91688901
N-ethyl-2,2,2-trifluoro-N-[2-methoxy-5-(2-oxochromen-3-yl)phenyl]acetamide (PubChem CID 91688901) has the molecular formula C20H16F3NO4 and a molecular weight of 391.35 g/mol. Its IUPAC name is N-ethyl-2,2,2-trifluoro-N-[2-methoxy-5-(2-oxochromen-3-yl)phenyl]acetamide.
| Compound Name | N-ethyl-2,2,2-trifluoro-N-[2-methoxy-5-(2-oxochromen-3-yl)phenyl]acetamide |
|---|---|
| PubChem CID | 91688901 |
| Molecular Formula | C20H16F3NO4 |
| Molecular Weight | 391.35 g/mol |
| Exact Mass | 391.10 |
| IUPAC Name | N-ethyl-2,2,2-trifluoro-N-[2-methoxy-5-(2-oxochromen-3-yl)phenyl]acetamide |
| SMILES | CCN(C(=O)C(F)(F)F)c1cc(-c2cc3ccccc3oc2=O)ccc1OC |
| InChI | InChI=1S/C20H16F3NO4/c1-3-24(19(26)20(21,22)23)15-11-12(8-9-17(15)27-2)14-10-13-6-4-5-7-16(13)28-18(14)25/h4-11H,3H2,1-2H3 |
| InChIKey | UHEQNYPEVWGSTJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 59.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.35 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|