C19H18F3NO3 — CID 175459373
3-[1-(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)-2,2,2-trifluoro-1-hydroxyethyl]chromen-2-one (PubChem CID 175459373) has the molecular formula C19H18F3NO3 and a molecular weight of 365.35 g/mol. Its IUPAC name is 3-[1-(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)-2,2,2-trifluoro-1-hydroxyethyl]chromen-2-one.
| Compound Name | 3-[1-(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)-2,2,2-trifluoro-1-hydroxyethyl]chromen-2-one |
|---|---|
| PubChem CID | 175459373 |
| Molecular Formula | C19H18F3NO3 |
| Molecular Weight | 365.35 g/mol |
| Exact Mass | 365.12 |
| IUPAC Name | 3-[1-(4-ethyl-3,5-dimethyl-1H-pyrrol-2-yl)-2,2,2-trifluoro-1-hydroxyethyl]chromen-2-one |
| SMILES | CCc1c(C)[nH]c(C(O)(c2cc3ccccc3oc2=O)C(F)(F)F)c1C |
| InChI | InChI=1S/C19H18F3NO3/c1-4-13-10(2)16(23-11(13)3)18(25,19(20,21)22)14-9-12-7-5-6-8-15(12)26-17(14)24/h5-9,23,25H,4H2,1-3H3 |
| InChIKey | QFBMKSRCOYWDSI-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 66.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.35 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|