C18H16F3NO4 — CID 175459388
3-[1-(2,5-dimethyl-1H-pyrrol-3-yl)-2,2,2-trifluoro-1-hydroxyethyl]-7-methoxychromen-2-one (PubChem CID 175459388) has the molecular formula C18H16F3NO4 and a molecular weight of 367.32 g/mol. Its IUPAC name is 3-[1-(2,5-dimethyl-1H-pyrrol-3-yl)-2,2,2-trifluoro-1-hydroxyethyl]-7-methoxychromen-2-one.
| Compound Name | 3-[1-(2,5-dimethyl-1H-pyrrol-3-yl)-2,2,2-trifluoro-1-hydroxyethyl]-7-methoxychromen-2-one |
|---|---|
| PubChem CID | 175459388 |
| Molecular Formula | C18H16F3NO4 |
| Molecular Weight | 367.32 g/mol |
| Exact Mass | 367.10 |
| IUPAC Name | 3-[1-(2,5-dimethyl-1H-pyrrol-3-yl)-2,2,2-trifluoro-1-hydroxyethyl]-7-methoxychromen-2-one |
| SMILES | COc1ccc2cc(C(O)(c3cc(C)[nH]c3C)C(F)(F)F)c(=O)oc2c1 |
| InChI | InChI=1S/C18H16F3NO4/c1-9-6-13(10(2)22-9)17(24,18(19,20)21)14-7-11-4-5-12(25-3)8-15(11)26-16(14)23/h4-8,22,24H,1-3H3 |
| InChIKey | USZBHZUSXLCWHE-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 75.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.32 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|