C43H47NO13 — CID 175462591
tert-butyl N-methyl-N-propoxycarbamate;[(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-hydroxyoxan-2-yl]methyl benzoate (PubChem CID 175462591) has the molecular formula C43H47NO13 and a molecular weight of 785.84 g/mol. Its IUPAC name is tert-butyl N-methyl-N-propoxycarbamate;[(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-hydroxyoxan-2-yl]methyl benzoate.
| Compound Name | tert-butyl N-methyl-N-propoxycarbamate;[(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-hydroxyoxan-2-yl]methyl benzoate |
|---|---|
| PubChem CID | 175462591 |
| Molecular Formula | C43H47NO13 |
| Molecular Weight | 785.84 g/mol |
| Exact Mass | 785.30 |
| IUPAC Name | tert-butyl N-methyl-N-propoxycarbamate;[(2R,3R,4S,5R,6R)-3,4,5-tribenzoyloxy-6-hydroxyoxan-2-yl]methyl benzoate |
| SMILES | CCCON(C)C(=O)OC(C)(C)C.O=C(OC[C@H]1O[C@@H](O)[C@H](OC(=O)c2ccccc2)[C@@H](OC(=O)c2ccccc2)[C@@H]1OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H28O10.C9H19NO3/c35-30(22-13-5-1-6-14-22)40-21-26-27(42-31(36)23-15-7-2-8-16-23)28(43-32(37)24-17-9-3-10-18-24)29(34(39)41-26)44-33(38)25-19-11-4-12-20-25;1-6-7-12-10(5)8(11)13-9(2,3)4/h1-20,26-29,34,39H,21H2;6-7H2,1-5H3/t26-,27-,28+,29-,34-;/m1./s1 |
| InChIKey | CIMZOGNYBXGIGM-IOFVLRDCSA-N |
| XLogP | 6.43 |
| TPSA | 173.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 57 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.84 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|