C21H30F3NO5 — CID 175485466
2-(1,1,2-trifluoro-4-nitro-9-phenylmethoxynonan-3-yl)oxyoxane (PubChem CID 175485466) has the molecular formula C21H30F3NO5 and a molecular weight of 433.47 g/mol. Its IUPAC name is 2-(1,1,2-trifluoro-4-nitro-9-phenylmethoxynonan-3-yl)oxyoxane.
| Compound Name | 2-(1,1,2-trifluoro-4-nitro-9-phenylmethoxynonan-3-yl)oxyoxane |
|---|---|
| PubChem CID | 175485466 |
| Molecular Formula | C21H30F3NO5 |
| Molecular Weight | 433.47 g/mol |
| Exact Mass | 433.21 |
| IUPAC Name | 2-(1,1,2-trifluoro-4-nitro-9-phenylmethoxynonan-3-yl)oxyoxane |
| SMILES | O=[N+]([O-])C(CCCCCOCc1ccccc1)C(OC1CCCCO1)C(F)C(F)F |
| InChI | InChI=1S/C21H30F3NO5/c22-19(21(23)24)20(30-18-12-6-8-14-29-18)17(25(26)27)11-5-2-7-13-28-15-16-9-3-1-4-10-16/h1,3-4,9-10,17-21H,2,5-8,11-15H2 |
| InChIKey | ZJAAKSWURLTXFZ-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|