C19H21BrFN3O4 — CID 175487668
[1-[6-bromo-4-(3-fluoro-4-methoxyphenyl)-5-methoxy-2-pyridinyl]piperidin-4-yl] carbamate (PubChem CID 175487668) has the molecular formula C19H21BrFN3O4 and a molecular weight of 454.30 g/mol. Its IUPAC name is [1-[6-bromo-4-(3-fluoro-4-methoxyphenyl)-5-methoxy-2-pyridinyl]piperidin-4-yl] carbamate.
| Compound Name | [1-[6-bromo-4-(3-fluoro-4-methoxyphenyl)-5-methoxy-2-pyridinyl]piperidin-4-yl] carbamate |
|---|---|
| PubChem CID | 175487668 |
| Molecular Formula | C19H21BrFN3O4 |
| Molecular Weight | 454.30 g/mol |
| Exact Mass | 453.07 |
| IUPAC Name | [1-[6-bromo-4-(3-fluoro-4-methoxyphenyl)-5-methoxy-2-pyridinyl]piperidin-4-yl] carbamate |
| SMILES | COc1ccc(-c2cc(N3CCC(OC(N)=O)CC3)nc(Br)c2OC)cc1F |
| InChI | InChI=1S/C19H21BrFN3O4/c1-26-15-4-3-11(9-14(15)21)13-10-16(23-18(20)17(13)27-2)24-7-5-12(6-8-24)28-19(22)25/h3-4,9-10,12H,5-8H2,1-2H3,(H2,22,25) |
| InChIKey | PSLBGYDZHPNXGM-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 86.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.30 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|