C9H9N3O3 — CID 175490671
benzene-1,3,5-triol;triazine (PubChem CID 175490671) has the molecular formula C9H9N3O3 and a molecular weight of 207.19 g/mol. Its IUPAC name is benzene-1,3,5-triol;triazine.
| Compound Name | benzene-1,3,5-triol;triazine |
|---|---|
| PubChem CID | 175490671 |
| Molecular Formula | C9H9N3O3 |
| Molecular Weight | 207.19 g/mol |
| Exact Mass | 207.06 |
| IUPAC Name | benzene-1,3,5-triol;triazine |
| SMILES | Oc1cc(O)cc(O)c1.c1cnnnc1 |
| InChI | InChI=1S/C6H6O3.C3H3N3/c7-4-1-5(8)3-6(9)2-4;1-2-4-6-5-3-1/h1-3,7-9H;1-3H |
| InChIKey | NVDGKRMCYBILOF-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 99.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.19 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |