C26H16Br4FeN4 — CID 175496052
21,22-dihydroporphyrin;iron;1,2,3,4-tetrabromobenzene (PubChem CID 175496052) has the molecular formula C26H16Br4FeN4 and a molecular weight of 759.90 g/mol. Its IUPAC name is 21,22-dihydroporphyrin;iron;1,2,3,4-tetrabromobenzene.
| Compound Name | 21,22-dihydroporphyrin;iron;1,2,3,4-tetrabromobenzene |
|---|---|
| PubChem CID | 175496052 |
| Molecular Formula | C26H16Br4FeN4 |
| Molecular Weight | 759.90 g/mol |
| Exact Mass | 755.75 |
| IUPAC Name | 21,22-dihydroporphyrin;iron;1,2,3,4-tetrabromobenzene |
| SMILES | Brc1ccc(Br)c(Br)c1Br.C1=Cc2cc3ccc(cc4ccc(cc5nc(cc1n2)C=C5)[nH]4)[nH]3.[Fe] |
| InChI | InChI=1S/C20H14N4.C6H2Br4.Fe/c1-2-14-10-16-5-6-18(23-16)12-20-8-7-19(24-20)11-17-4-3-15(22-17)9-13(1)21-14;7-3-1-2-4(8)6(10)5(3)9;/h1-12,21-22H;1-2H;/b13-9-,14-10-,15-9-,16-10-,17-11-,18-12-,19-11-,20-12-;; |
| InChIKey | GIYKSGCESMWJLZ-IAULSPAKSA-N |
| XLogP | 9.39 |
| TPSA | 57.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 759.90 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|