About (2-acetyl-3-oxobutanoyl) 4-hydroxybenzoate
(2-acetyl-3-oxobutanoyl) 4-hydroxybenzoate (PubChem CID 175496943) has the molecular formula C13H12O6
and a molecular weight of 264.23 g/mol. Its IUPAC name is (2-acetyl-3-oxobutanoyl) 4-hydroxybenzoate.
Molecular Properties
| Compound Name | (2-acetyl-3-oxobutanoyl) 4-hydroxybenzoate |
| PubChem CID | 175496943 |
| Molecular Formula | C13H12O6 |
| Molecular Weight | 264.23 g/mol |
| Exact Mass | 264.06 |
| IUPAC Name | (2-acetyl-3-oxobutanoyl) 4-hydroxybenzoate |
| SMILES | CC(=O)C(C(C)=O)C(=O)OC(=O)c1ccc(O)cc1 |
| InChI | InChI=1S/C13H12O6/c1-7(14)11(8(2)15)13(18)19-12(17)9-3-5-10(16)6-4-9/h3-6,11,16H,1-2H3 |
| InChIKey | FGNJQGRQJGAXLA-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 97.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 264.23 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze (2-acetyl-3-oxobutanoyl) 4-hydroxybenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-acetyl-3-oxobutanoyl) 4-hydroxybenzoate?
The IUPAC name of (2-acetyl-3-oxobutanoyl) 4-hydroxybenzoate (CID 175496943) is (2-acetyl-3-oxobutanoyl) 4-hydroxybenzoate.
What is the SMILES notation for (2-acetyl-3-oxobutanoyl) 4-hydroxybenzoate?
The canonical SMILES for (2-acetyl-3-oxobutanoyl) 4-hydroxybenzoate is CC(=O)C(C(C)=O)C(=O)OC(=O)c1ccc(O)cc1.
What is the InChIKey of (2-acetyl-3-oxobutanoyl) 4-hydroxybenzoate?
The InChIKey is FGNJQGRQJGAXLA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12O6/c1-7(14)11(8(2)15)13(18)19-12(17)9-3-5-10(16)6-4-9/h3-6,11,16H,1-2H3.
What are the key properties of (2-acetyl-3-oxobutanoyl) 4-hydroxybenzoate?
(2-acetyl-3-oxobutanoyl) 4-hydroxybenzoate has a molecular weight of 264.23 g/mol, XLogP of 0.87, 4 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2-acetyl-3-oxobutanoyl) 4-hydroxybenzoate is sourced from PubChem (CID 175496943), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).