C12H13BF3NO5 — CID 175500254
1-hydroxy-4-(trifluoromethyl)-3H-2,1-benzoxaborole-6-carboxamide;propanoic acid (PubChem CID 175500254) has the molecular formula C12H13BF3NO5 and a molecular weight of 319.04 g/mol. Its IUPAC name is 1-hydroxy-4-(trifluoromethyl)-3H-2,1-benzoxaborole-6-carboxamide;propanoic acid.
| Compound Name | 1-hydroxy-4-(trifluoromethyl)-3H-2,1-benzoxaborole-6-carboxamide;propanoic acid |
|---|---|
| PubChem CID | 175500254 |
| Molecular Formula | C12H13BF3NO5 |
| Molecular Weight | 319.04 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | 1-hydroxy-4-(trifluoromethyl)-3H-2,1-benzoxaborole-6-carboxamide;propanoic acid |
| SMILES | CCC(=O)O.NC(=O)c1cc2c(c(C(F)(F)F)c1)COB2O |
| InChI | InChI=1S/C9H7BF3NO3.C3H6O2/c11-9(12,13)6-1-4(8(14)15)2-7-5(6)3-17-10(7)16;1-2-3(4)5/h1-2,16H,3H2,(H2,14,15);2H2,1H3,(H,4,5) |
| InChIKey | QVAPONGTWHAHTH-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 109.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.04 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|