About (Z)-but-2-enedioic acid;1-methyl-3-octylimidazol-1-ium;bromide
(Z)-but-2-enedioic acid;1-methyl-3-octylimidazol-1-ium;bromide (PubChem CID 175511803) has the molecular formula C16H27BrN2O4
and a molecular weight of 391.31 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;1-methyl-3-octylimidazol-1-ium;bromide.
Molecular Properties
| Compound Name | (Z)-but-2-enedioic acid;1-methyl-3-octylimidazol-1-ium;bromide |
| PubChem CID | 175511803 |
| Molecular Formula | C16H27BrN2O4 |
| Molecular Weight | 391.31 g/mol |
| Exact Mass | 390.12 |
| IUPAC Name | (Z)-but-2-enedioic acid;1-methyl-3-octylimidazol-1-ium;bromide |
| SMILES | CCCCCCCCn1cc[n+](C)c1.O=C(O)/C=C\C(=O)O.[Br-] |
| InChI | InChI=1S/C12H23N2.C4H4O4.BrH/c1-3-4-5-6-7-8-9-14-11-10-13(2)12-14;5-3(6)1-2-4(7)8;/h10-12H,3-9H2,1-2H3;1-2H,(H,5,6)(H,7,8);1H/q+1;;/p-1/b;2-1-; |
| InChIKey | IZRARGFBZXSREC-FJOGWHKWSA-M |
| XLogP | -0.61 |
| TPSA | 83.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 391.31 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze (Z)-but-2-enedioic acid;1-methyl-3-octylimidazol-1-ium;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-but-2-enedioic acid;1-methyl-3-octylimidazol-1-ium;bromide?
The IUPAC name of (Z)-but-2-enedioic acid;1-methyl-3-octylimidazol-1-ium;bromide (CID 175511803) is (Z)-but-2-enedioic acid;1-methyl-3-octylimidazol-1-ium;bromide.
What is the SMILES notation for (Z)-but-2-enedioic acid;1-methyl-3-octylimidazol-1-ium;bromide?
The canonical SMILES for (Z)-but-2-enedioic acid;1-methyl-3-octylimidazol-1-ium;bromide is CCCCCCCCn1cc[n+](C)c1.O=C(O)/C=C\C(=O)O.[Br-].
What is the InChIKey of (Z)-but-2-enedioic acid;1-methyl-3-octylimidazol-1-ium;bromide?
The InChIKey is IZRARGFBZXSREC-FJOGWHKWSA-M. The full InChI is InChI=1S/C12H23N2.C4H4O4.BrH/c1-3-4-5-6-7-8-9-14-11-10-13(2)12-14;5-3(6)1-2-4(7)8;/h10-12H,3-9H2,1-2H3;1-2H,(H,5,6)(H,7,8);1H/q+1;;/p-1/b;2-1-;.
What are the key properties of (Z)-but-2-enedioic acid;1-methyl-3-octylimidazol-1-ium;bromide?
(Z)-but-2-enedioic acid;1-methyl-3-octylimidazol-1-ium;bromide has a molecular weight of 391.31 g/mol, XLogP of -0.61, 9 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-but-2-enedioic acid;1-methyl-3-octylimidazol-1-ium;bromide is sourced from PubChem (CID 175511803), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).