About azidomethane;trifluoromethylbenzene
azidomethane;trifluoromethylbenzene (PubChem CID 175515573) has the molecular formula C8H8F3N3
and a molecular weight of 203.17 g/mol. Its IUPAC name is azidomethane;trifluoromethylbenzene.
Molecular Properties
| Compound Name | azidomethane;trifluoromethylbenzene |
| PubChem CID | 175515573 |
| Molecular Formula | C8H8F3N3 |
| Molecular Weight | 203.17 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | azidomethane;trifluoromethylbenzene |
| SMILES | CN=[N+]=[N-].FC(F)(F)c1ccccc1 |
| InChI | InChI=1S/C7H5F3.CH3N3/c8-7(9,10)6-4-2-1-3-5-6;1-3-4-2/h1-5H;1H3 |
| InChIKey | SSNOCLVSMMCYBJ-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.17 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze azidomethane;trifluoromethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azidomethane;trifluoromethylbenzene?
The IUPAC name of azidomethane;trifluoromethylbenzene (CID 175515573) is azidomethane;trifluoromethylbenzene.
What is the SMILES notation for azidomethane;trifluoromethylbenzene?
The canonical SMILES for azidomethane;trifluoromethylbenzene is CN=[N+]=[N-].FC(F)(F)c1ccccc1.
What is the InChIKey of azidomethane;trifluoromethylbenzene?
The InChIKey is SSNOCLVSMMCYBJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5F3.CH3N3/c8-7(9,10)6-4-2-1-3-5-6;1-3-4-2/h1-5H;1H3.
What are the key properties of azidomethane;trifluoromethylbenzene?
azidomethane;trifluoromethylbenzene has a molecular weight of 203.17 g/mol, XLogP of 3.63, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for azidomethane;trifluoromethylbenzene is sourced from PubChem (CID 175515573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).