C13H17BN4O2 — CID 175535385
5-[(4,5,5-trimethyl-2-phenyl-1,3,2-dioxaborolan-4-yl)methyl]-2H-tetrazole (PubChem CID 175535385) has the molecular formula C13H17BN4O2 and a molecular weight of 272.12 g/mol. Its IUPAC name is 5-[(4,5,5-trimethyl-2-phenyl-1,3,2-dioxaborolan-4-yl)methyl]-2H-tetrazole.
| Compound Name | 5-[(4,5,5-trimethyl-2-phenyl-1,3,2-dioxaborolan-4-yl)methyl]-2H-tetrazole |
|---|---|
| PubChem CID | 175535385 |
| Molecular Formula | C13H17BN4O2 |
| Molecular Weight | 272.12 g/mol |
| Exact Mass | 272.14 |
| IUPAC Name | 5-[(4,5,5-trimethyl-2-phenyl-1,3,2-dioxaborolan-4-yl)methyl]-2H-tetrazole |
| SMILES | CC1(C)OB(c2ccccc2)OC1(C)Cc1nn[nH]n1 |
| InChI | InChI=1S/C13H17BN4O2/c1-12(2)13(3,9-11-15-17-18-16-11)20-14(19-12)10-7-5-4-6-8-10/h4-8H,9H2,1-3H3,(H,15,16,17,18) |
| InChIKey | WWESTFWRXAJCEE-UHFFFAOYSA-N |
| XLogP | 0.72 |
| TPSA | 72.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.12 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|