C20H17ClN4O2 — CID 175540541
1-[1-(4-chloro-3-oxo-1H-pyrazol-2-yl)-4-phenylcyclohexa-2,4-dien-1-yl]-N-cyanocyclopropane-1-carboxamide (PubChem CID 175540541) has the molecular formula C20H17ClN4O2 and a molecular weight of 380.84 g/mol. Its IUPAC name is 1-[1-(4-chloro-3-oxo-1H-pyrazol-2-yl)-4-phenylcyclohexa-2,4-dien-1-yl]-N-cyanocyclopropane-1-carboxamide.
| Compound Name | 1-[1-(4-chloro-3-oxo-1H-pyrazol-2-yl)-4-phenylcyclohexa-2,4-dien-1-yl]-N-cyanocyclopropane-1-carboxamide |
|---|---|
| PubChem CID | 175540541 |
| Molecular Formula | C20H17ClN4O2 |
| Molecular Weight | 380.84 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 1-[1-(4-chloro-3-oxo-1H-pyrazol-2-yl)-4-phenylcyclohexa-2,4-dien-1-yl]-N-cyanocyclopropane-1-carboxamide |
| SMILES | N#CNC(=O)C1(C2(n3[nH]cc(Cl)c3=O)C=CC(c3ccccc3)=CC2)CC1 |
| InChI | InChI=1S/C20H17ClN4O2/c21-16-12-24-25(17(16)26)20(19(10-11-19)18(27)23-13-22)8-6-15(7-9-20)14-4-2-1-3-5-14/h1-8,12,24H,9-11H2,(H,23,27) |
| InChIKey | YTNYELSQDNEPNC-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 90.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.84 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|