C24H32N4OS — CID 154453051
(2R)-N-(cyanomethyl)-4-methyl-2-(4-phenyl-1-piperazin-1-ylcyclohexa-2,4-dien-1-yl)sulfanylpentanamide (PubChem CID 154453051) has the molecular formula C24H32N4OS and a molecular weight of 424.61 g/mol. Its IUPAC name is (2R)-N-(cyanomethyl)-4-methyl-2-(4-phenyl-1-piperazin-1-ylcyclohexa-2,4-dien-1-yl)sulfanylpentanamide.
| Compound Name | (2R)-N-(cyanomethyl)-4-methyl-2-(4-phenyl-1-piperazin-1-ylcyclohexa-2,4-dien-1-yl)sulfanylpentanamide |
|---|---|
| PubChem CID | 154453051 |
| Molecular Formula | C24H32N4OS |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.23 |
| IUPAC Name | (2R)-N-(cyanomethyl)-4-methyl-2-(4-phenyl-1-piperazin-1-ylcyclohexa-2,4-dien-1-yl)sulfanylpentanamide |
| SMILES | CC(C)C[C@@H](SC1(N2CCNCC2)C=CC(c2ccccc2)=CC1)C(=O)NCC#N |
| InChI | InChI=1S/C24H32N4OS/c1-19(2)18-22(23(29)27-13-12-25)30-24(28-16-14-26-15-17-28)10-8-21(9-11-24)20-6-4-3-5-7-20/h3-10,19,22,26H,11,13-18H2,1-2H3,(H,27,29)/t22-,24?/m1/s1 |
| InChIKey | FBYMKYGXUXSSCH-LETIRJCYSA-N |
| XLogP | 3.42 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'} |
|---|