C25H36N2O3S2Si — CID 154453059
N-(cyanomethyl)-4-methyl-2-[4-phenyl-1-(2-trimethylsilylethylsulfonyl)cyclohexa-2,4-dien-1-yl]sulfanylpentanamide (PubChem CID 154453059) has the molecular formula C25H36N2O3S2Si and a molecular weight of 504.79 g/mol. Its IUPAC name is N-(cyanomethyl)-4-methyl-2-[4-phenyl-1-(2-trimethylsilylethylsulfonyl)cyclohexa-2,4-dien-1-yl]sulfanylpentanamide.
| Compound Name | N-(cyanomethyl)-4-methyl-2-[4-phenyl-1-(2-trimethylsilylethylsulfonyl)cyclohexa-2,4-dien-1-yl]sulfanylpentanamide |
|---|---|
| PubChem CID | 154453059 |
| Molecular Formula | C25H36N2O3S2Si |
| Molecular Weight | 504.79 g/mol |
| Exact Mass | 504.19 |
| IUPAC Name | N-(cyanomethyl)-4-methyl-2-[4-phenyl-1-(2-trimethylsilylethylsulfonyl)cyclohexa-2,4-dien-1-yl]sulfanylpentanamide |
| SMILES | CC(C)CC(SC1(S(=O)(=O)CC[Si](C)(C)C)C=CC(c2ccccc2)=CC1)C(=O)NCC#N |
| InChI | InChI=1S/C25H36N2O3S2Si/c1-20(2)19-23(24(28)27-16-15-26)31-25(32(29,30)17-18-33(3,4)5)13-11-22(12-14-25)21-9-7-6-8-10-21/h6-13,20,23H,14,16-19H2,1-5H3,(H,27,28) |
| InChIKey | RSWGWKSLLGBRDW-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 87.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.79 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cyanamide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|