C20H28N2O6S — CID 174631116
N-hydroxy-2-[(1-methoxy-4-phenylcyclohexa-2,4-dien-1-yl)sulfonyl-propan-2-yloxyamino]butanamide (PubChem CID 174631116) has the molecular formula C20H28N2O6S and a molecular weight of 424.52 g/mol. Its IUPAC name is N-hydroxy-2-[(1-methoxy-4-phenylcyclohexa-2,4-dien-1-yl)sulfonyl-propan-2-yloxyamino]butanamide.
| Compound Name | N-hydroxy-2-[(1-methoxy-4-phenylcyclohexa-2,4-dien-1-yl)sulfonyl-propan-2-yloxyamino]butanamide |
|---|---|
| PubChem CID | 174631116 |
| Molecular Formula | C20H28N2O6S |
| Molecular Weight | 424.52 g/mol |
| Exact Mass | 424.17 |
| IUPAC Name | N-hydroxy-2-[(1-methoxy-4-phenylcyclohexa-2,4-dien-1-yl)sulfonyl-propan-2-yloxyamino]butanamide |
| SMILES | CCC(C(=O)NO)N(OC(C)C)S(=O)(=O)C1(OC)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C20H28N2O6S/c1-5-18(19(23)21-24)22(28-15(2)3)29(25,26)20(27-4)13-11-17(12-14-20)16-9-7-6-8-10-16/h6-13,15,18,24H,5,14H2,1-4H3,(H,21,23) |
| InChIKey | WGVFHXXQVATBFG-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 105.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.52 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|