C24H34N2O8S2 — CID 87730177
1-N,1-N-bis(2-methoxyethyl)-1-N',1-N'-bis(oxiran-2-ylmethyl)-4-phenylcyclohexa-2,4-diene-1,1-disulfonamide (PubChem CID 87730177) has the molecular formula C24H34N2O8S2 and a molecular weight of 542.68 g/mol. Its IUPAC name is 1-N,1-N-bis(2-methoxyethyl)-1-N',1-N'-bis(oxiran-2-ylmethyl)-4-phenylcyclohexa-2,4-diene-1,1-disulfonamide.
| Compound Name | 1-N,1-N-bis(2-methoxyethyl)-1-N',1-N'-bis(oxiran-2-ylmethyl)-4-phenylcyclohexa-2,4-diene-1,1-disulfonamide |
|---|---|
| PubChem CID | 87730177 |
| Molecular Formula | C24H34N2O8S2 |
| Molecular Weight | 542.68 g/mol |
| Exact Mass | 542.18 |
| IUPAC Name | 1-N,1-N-bis(2-methoxyethyl)-1-N',1-N'-bis(oxiran-2-ylmethyl)-4-phenylcyclohexa-2,4-diene-1,1-disulfonamide |
| SMILES | COCCN(CCOC)S(=O)(=O)C1(S(=O)(=O)N(CC2CO2)CC2CO2)C=CC(c2ccccc2)=CC1 |
| InChI | InChI=1S/C24H34N2O8S2/c1-31-14-12-25(13-15-32-2)35(27,28)24(10-8-21(9-11-24)20-6-4-3-5-7-20)36(29,30)26(16-22-18-33-22)17-23-19-34-23/h3-10,22-23H,11-19H2,1-2H3 |
| InChIKey | FXEJBPKMECOCRI-UHFFFAOYSA-N |
| XLogP | 1.08 |
| TPSA | 118.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.68 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|