C19H19ClN4O3 — CID 97303623
N-(6-amino-3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)-2-[(1R)-1-chloro-4-phenylcyclohexa-2,4-dien-1-yl]acetamide (PubChem CID 97303623) has the molecular formula C19H19ClN4O3 and a molecular weight of 386.84 g/mol. Its IUPAC name is N-(6-amino-3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)-2-[(1R)-1-chloro-4-phenylcyclohexa-2,4-dien-1-yl]acetamide.
| Compound Name | N-(6-amino-3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)-2-[(1R)-1-chloro-4-phenylcyclohexa-2,4-dien-1-yl]acetamide |
|---|---|
| PubChem CID | 97303623 |
| Molecular Formula | C19H19ClN4O3 |
| Molecular Weight | 386.84 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | N-(6-amino-3-methyl-2,4-dioxo-1H-pyrimidin-5-yl)-2-[(1R)-1-chloro-4-phenylcyclohexa-2,4-dien-1-yl]acetamide |
| SMILES | Cn1c(=O)[nH]c(N)c(NC(=O)C[C@@]2(Cl)C=CC(c3ccccc3)=CC2)c1=O |
| InChI | InChI=1S/C19H19ClN4O3/c1-24-17(26)15(16(21)23-18(24)27)22-14(25)11-19(20)9-7-13(8-10-19)12-5-3-2-4-6-12/h2-9H,10-11,21H2,1H3,(H,22,25)(H,23,27)/t19-/m1/s1 |
| InChIKey | ZRSYMVKVZPOJEL-LJQANCHMSA-N |
| XLogP | 2.01 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.84 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|