C18H19ClF3NO3 — CID 175541705
tert-butyl N-(4-chlorophenyl)-N-(4-cyclopropyl-1,1,1-trifluoro-2-hydroxybut-3-yn-2-yl)carbamate (PubChem CID 175541705) has the molecular formula C18H19ClF3NO3 and a molecular weight of 389.80 g/mol. Its IUPAC name is tert-butyl N-(4-chlorophenyl)-N-(4-cyclopropyl-1,1,1-trifluoro-2-hydroxybut-3-yn-2-yl)carbamate.
| Compound Name | tert-butyl N-(4-chlorophenyl)-N-(4-cyclopropyl-1,1,1-trifluoro-2-hydroxybut-3-yn-2-yl)carbamate |
|---|---|
| PubChem CID | 175541705 |
| Molecular Formula | C18H19ClF3NO3 |
| Molecular Weight | 389.80 g/mol |
| Exact Mass | 389.10 |
| IUPAC Name | tert-butyl N-(4-chlorophenyl)-N-(4-cyclopropyl-1,1,1-trifluoro-2-hydroxybut-3-yn-2-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(c1ccc(Cl)cc1)C(O)(C#CC1CC1)C(F)(F)F |
| InChI | InChI=1S/C18H19ClF3NO3/c1-16(2,3)26-15(24)23(14-8-6-13(19)7-9-14)17(25,18(20,21)22)11-10-12-4-5-12/h6-9,12,25H,4-5H2,1-3H3 |
| InChIKey | MMLCQGMSJWXWOS-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.80 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|