C22H23ClINO4S — CID 131745821
tert-butyl N-(4-chlorophenyl)-N-[5-(iodomethyl)-1-sulfonyl-3,4-dihydro-2H-naphthalen-2-yl]carbamate (PubChem CID 131745821) has the molecular formula C22H23ClINO4S and a molecular weight of 559.85 g/mol. Its IUPAC name is tert-butyl N-(4-chlorophenyl)-N-[5-(iodomethyl)-1-sulfonyl-3,4-dihydro-2H-naphthalen-2-yl]carbamate.
| Compound Name | tert-butyl N-(4-chlorophenyl)-N-[5-(iodomethyl)-1-sulfonyl-3,4-dihydro-2H-naphthalen-2-yl]carbamate |
|---|---|
| PubChem CID | 131745821 |
| Molecular Formula | C22H23ClINO4S |
| Molecular Weight | 559.85 g/mol |
| Exact Mass | 559.01 |
| IUPAC Name | tert-butyl N-(4-chlorophenyl)-N-[5-(iodomethyl)-1-sulfonyl-3,4-dihydro-2H-naphthalen-2-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N(c1ccc(Cl)cc1)C1CCc2c(CI)cccc2C1=S(=O)=O |
| InChI | InChI=1S/C22H23ClINO4S/c1-22(2,3)29-21(26)25(16-9-7-15(23)8-10-16)19-12-11-17-14(13-24)5-4-6-18(17)20(19)30(27)28/h4-10,19H,11-13H2,1-3H3 |
| InChIKey | AYOKMAITYNHNNZ-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.85 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|