C14H29N3O2Si — CID 175542314
1-[2-[tert-butyl(dimethyl)silyl]oxy-3-methoxypropyl]-3-methylpyrazol-4-amine (PubChem CID 175542314) has the molecular formula C14H29N3O2Si and a molecular weight of 299.49 g/mol. Its IUPAC name is 1-[2-[tert-butyl(dimethyl)silyl]oxy-3-methoxypropyl]-3-methylpyrazol-4-amine.
| Compound Name | 1-[2-[tert-butyl(dimethyl)silyl]oxy-3-methoxypropyl]-3-methylpyrazol-4-amine |
|---|---|
| PubChem CID | 175542314 |
| Molecular Formula | C14H29N3O2Si |
| Molecular Weight | 299.49 g/mol |
| Exact Mass | 299.20 |
| IUPAC Name | 1-[2-[tert-butyl(dimethyl)silyl]oxy-3-methoxypropyl]-3-methylpyrazol-4-amine |
| SMILES | COCC(Cn1cc(N)c(C)n1)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H29N3O2Si/c1-11-13(15)9-17(16-11)8-12(10-18-5)19-20(6,7)14(2,3)4/h9,12H,8,10,15H2,1-7H3 |
| InChIKey | OXPQBQWDDDLMPS-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.49 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|