About 2-oxoethyl 3-oxohexanoate
2-oxoethyl 3-oxohexanoate (PubChem CID 175545562) has the molecular formula C8H12O4
and a molecular weight of 172.18 g/mol. Its IUPAC name is 2-oxoethyl 3-oxohexanoate.
Molecular Properties
| Compound Name | 2-oxoethyl 3-oxohexanoate |
| PubChem CID | 175545562 |
| Molecular Formula | C8H12O4 |
| Molecular Weight | 172.18 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 2-oxoethyl 3-oxohexanoate |
| SMILES | CCCC(=O)CC(=O)OCC=O |
| InChI | InChI=1S/C8H12O4/c1-2-3-7(10)6-8(11)12-5-4-9/h4H,2-3,5-6H2,1H3 |
| InChIKey | GIOVXIURZRXEQF-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 172.18 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 2-oxoethyl 3-oxohexanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-oxoethyl 3-oxohexanoate?
The IUPAC name of 2-oxoethyl 3-oxohexanoate (CID 175545562) is 2-oxoethyl 3-oxohexanoate.
What is the SMILES notation for 2-oxoethyl 3-oxohexanoate?
The canonical SMILES for 2-oxoethyl 3-oxohexanoate is CCCC(=O)CC(=O)OCC=O.
What is the InChIKey of 2-oxoethyl 3-oxohexanoate?
The InChIKey is GIOVXIURZRXEQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12O4/c1-2-3-7(10)6-8(11)12-5-4-9/h4H,2-3,5-6H2,1H3.
What are the key properties of 2-oxoethyl 3-oxohexanoate?
2-oxoethyl 3-oxohexanoate has a molecular weight of 172.18 g/mol, XLogP of 0.49, 6 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-oxoethyl 3-oxohexanoate is sourced from PubChem (CID 175545562), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).