C27H58P2 — CID 175546679
bis(1,2-bis(2-methylpropyl)phosphinane);methane (PubChem CID 175546679) has the molecular formula C27H58P2 and a molecular weight of 444.71 g/mol. Its IUPAC name is bis(1,2-bis(2-methylpropyl)phosphinane);methane.
| Compound Name | bis(1,2-bis(2-methylpropyl)phosphinane);methane |
|---|---|
| PubChem CID | 175546679 |
| Molecular Formula | C27H58P2 |
| Molecular Weight | 444.71 g/mol |
| Exact Mass | 444.40 |
| IUPAC Name | bis(1,2-bis(2-methylpropyl)phosphinane);methane |
| SMILES | C.CC(C)CC1CCCCP1CC(C)C.CC(C)CC1CCCCP1CC(C)C |
| InChI | InChI=1S/2C13H27P.CH4/c2*1-11(2)9-13-7-5-6-8-14(13)10-12(3)4;/h2*11-13H,5-10H2,1-4H3;1H4 |
| InChIKey | KIJLFEFCPRNRPI-UHFFFAOYSA-N |
| XLogP | 10.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.71 |
| LogP ≤ 5 | 10.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|