C22H37N2O9P — CID 175552670
(2S)-6-amino-2-[(4-diethoxyphosphoryloxyphenyl)methoxycarbonylamino]hexanoic acid;oxolane (PubChem CID 175552670) has the molecular formula C22H37N2O9P and a molecular weight of 504.52 g/mol. Its IUPAC name is (2S)-6-amino-2-[(4-diethoxyphosphoryloxyphenyl)methoxycarbonylamino]hexanoic acid;oxolane.
| Compound Name | (2S)-6-amino-2-[(4-diethoxyphosphoryloxyphenyl)methoxycarbonylamino]hexanoic acid;oxolane |
|---|---|
| PubChem CID | 175552670 |
| Molecular Formula | C22H37N2O9P |
| Molecular Weight | 504.52 g/mol |
| Exact Mass | 504.22 |
| IUPAC Name | (2S)-6-amino-2-[(4-diethoxyphosphoryloxyphenyl)methoxycarbonylamino]hexanoic acid;oxolane |
| SMILES | C1CCOC1.CCOP(=O)(OCC)Oc1ccc(COC(=O)N[C@@H](CCCCN)C(=O)O)cc1 |
| InChI | InChI=1S/C18H29N2O8P.C4H8O/c1-3-26-29(24,27-4-2)28-15-10-8-14(9-11-15)13-25-18(23)20-16(17(21)22)7-5-6-12-19;1-2-4-5-3-1/h8-11,16H,3-7,12-13,19H2,1-2H3,(H,20,23)(H,21,22);1-4H2/t16-;/m0./s1 |
| InChIKey | LXGYDSJOVQBMCC-NTISSMGPSA-N |
| XLogP | 3.85 |
| TPSA | 155.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.52 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|