C20H31N3O8 — CID 90003884
(2S)-2-amino-4-methylpentanedioic acid;(2S)-6-amino-2-(phenylmethoxycarbonylamino)hexanoic acid (PubChem CID 90003884) has the molecular formula C20H31N3O8 and a molecular weight of 441.48 g/mol. Its IUPAC name is (2S)-2-amino-4-methylpentanedioic acid;(2S)-6-amino-2-(phenylmethoxycarbonylamino)hexanoic acid.
| Compound Name | (2S)-2-amino-4-methylpentanedioic acid;(2S)-6-amino-2-(phenylmethoxycarbonylamino)hexanoic acid |
|---|---|
| PubChem CID | 90003884 |
| Molecular Formula | C20H31N3O8 |
| Molecular Weight | 441.48 g/mol |
| Exact Mass | 441.21 |
| IUPAC Name | (2S)-2-amino-4-methylpentanedioic acid;(2S)-6-amino-2-(phenylmethoxycarbonylamino)hexanoic acid |
| SMILES | CC(C[C@H](N)C(=O)O)C(=O)O.NCCCC[C@H](NC(=O)OCc1ccccc1)C(=O)O |
| InChI | InChI=1S/C14H20N2O4.C6H11NO4/c15-9-5-4-8-12(13(17)18)16-14(19)20-10-11-6-2-1-3-7-11;1-3(5(8)9)2-4(7)6(10)11/h1-3,6-7,12H,4-5,8-10,15H2,(H,16,19)(H,17,18);3-4H,2,7H2,1H3,(H,8,9)(H,10,11)/t12-;3?,4-/m00/s1 |
| InChIKey | YYPJQZWSFYCFMC-JDLNHQCRSA-N |
| XLogP | 1.00 |
| TPSA | 202.27 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.48 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|