C28H32N2O8 — CID 175558580
prop-2-enyl 3-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methoxy-3-oxopropoxy]methyl]morpholine-4-carboxylate (PubChem CID 175558580) has the molecular formula C28H32N2O8 and a molecular weight of 524.57 g/mol. Its IUPAC name is prop-2-enyl 3-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methoxy-3-oxopropoxy]methyl]morpholine-4-carboxylate.
| Compound Name | prop-2-enyl 3-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methoxy-3-oxopropoxy]methyl]morpholine-4-carboxylate |
|---|---|
| PubChem CID | 175558580 |
| Molecular Formula | C28H32N2O8 |
| Molecular Weight | 524.57 g/mol |
| Exact Mass | 524.22 |
| IUPAC Name | prop-2-enyl 3-[[2-(9H-fluoren-9-ylmethoxycarbonylamino)-3-methoxy-3-oxopropoxy]methyl]morpholine-4-carboxylate |
| SMILES | C=CCOC(=O)N1CCOCC1COCC(NC(=O)OCC1c2ccccc2-c2ccccc21)C(=O)OC |
| InChI | InChI=1S/C28H32N2O8/c1-3-13-37-28(33)30-12-14-35-15-19(30)16-36-18-25(26(31)34-2)29-27(32)38-17-24-22-10-6-4-8-20(22)21-9-5-7-11-23(21)24/h3-11,19,24-25H,1,12-18H2,2H3,(H,29,32) |
| InChIKey | LITVYZHFGPZQIZ-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 112.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.57 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|