C18H10BrClF2N3+ — CID 175560702
9-bromo-8-chloro-7-(2,6-difluorophenyl)-5H-pyrimido[1,2-a][1,4]benzodiazepin-12-ium (PubChem CID 175560702) has the molecular formula C18H10BrClF2N3+ and a molecular weight of 421.65 g/mol. Its IUPAC name is 9-bromo-8-chloro-7-(2,6-difluorophenyl)-5H-pyrimido[1,2-a][1,4]benzodiazepin-12-ium.
| Compound Name | 9-bromo-8-chloro-7-(2,6-difluorophenyl)-5H-pyrimido[1,2-a][1,4]benzodiazepin-12-ium |
|---|---|
| PubChem CID | 175560702 |
| Molecular Formula | C18H10BrClF2N3+ |
| Molecular Weight | 421.65 g/mol |
| Exact Mass | 419.97 |
| IUPAC Name | 9-bromo-8-chloro-7-(2,6-difluorophenyl)-5H-pyrimido[1,2-a][1,4]benzodiazepin-12-ium |
| SMILES | Fc1cccc(F)c1C1=NCc2nccc[n+]2-c2ccc(Br)c(Cl)c21 |
| InChI | InChI=1S/C18H10BrClF2N3/c19-10-5-6-13-16(17(10)20)18(15-11(21)3-1-4-12(15)22)24-9-14-23-7-2-8-25(13)14/h1-8H,9H2/q+1 |
| InChIKey | WOMKETUOJAEYNJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 29.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.65 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|