C30H32N4O3 — CID 175563898
4-ethyl-4-[hydroxy-(1-trityl-1,2,4-triazol-3-yl)methyl]piperidine-1-carboxylic acid (PubChem CID 175563898) has the molecular formula C30H32N4O3 and a molecular weight of 496.61 g/mol. Its IUPAC name is 4-ethyl-4-[hydroxy-(1-trityl-1,2,4-triazol-3-yl)methyl]piperidine-1-carboxylic acid.
| Compound Name | 4-ethyl-4-[hydroxy-(1-trityl-1,2,4-triazol-3-yl)methyl]piperidine-1-carboxylic acid |
|---|---|
| PubChem CID | 175563898 |
| Molecular Formula | C30H32N4O3 |
| Molecular Weight | 496.61 g/mol |
| Exact Mass | 496.25 |
| IUPAC Name | 4-ethyl-4-[hydroxy-(1-trityl-1,2,4-triazol-3-yl)methyl]piperidine-1-carboxylic acid |
| SMILES | CCC1(C(O)c2ncn(C(c3ccccc3)(c3ccccc3)c3ccccc3)n2)CCN(C(=O)O)CC1 |
| InChI | InChI=1S/C30H32N4O3/c1-2-29(18-20-33(21-19-29)28(36)37)26(35)27-31-22-34(32-27)30(23-12-6-3-7-13-23,24-14-8-4-9-15-24)25-16-10-5-11-17-25/h3-17,22,26,35H,2,18-21H2,1H3,(H,36,37) |
| InChIKey | ZFMZRBLGBSBIQD-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 91.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.61 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|