C25H26ClN7O2S — CID 175566702
1-[5-[5-chloro-2-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]-1,3-thiazol-2-yl]azepin-3-ol (PubChem CID 175566702) has the molecular formula C25H26ClN7O2S and a molecular weight of 524.05 g/mol. Its IUPAC name is 1-[5-[5-chloro-2-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]-1,3-thiazol-2-yl]azepin-3-ol.
| Compound Name | 1-[5-[5-chloro-2-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]-1,3-thiazol-2-yl]azepin-3-ol |
|---|---|
| PubChem CID | 175566702 |
| Molecular Formula | C25H26ClN7O2S |
| Molecular Weight | 524.05 g/mol |
| Exact Mass | 523.16 |
| IUPAC Name | 1-[5-[5-chloro-2-[3-methoxy-4-(4-methylpiperazin-1-yl)anilino]pyrimidin-4-yl]-1,3-thiazol-2-yl]azepin-3-ol |
| SMILES | COc1cc(Nc2ncc(Cl)c(-c3cnc(N4C=CC=CC(O)=C4)s3)n2)ccc1N1CCN(C)CC1 |
| InChI | InChI=1S/C25H26ClN7O2S/c1-31-9-11-32(12-10-31)20-7-6-17(13-21(20)35-2)29-24-27-14-19(26)23(30-24)22-15-28-25(36-22)33-8-4-3-5-18(34)16-33/h3-8,13-16,34H,9-12H2,1-2H3,(H,27,29,30) |
| InChIKey | DGPGEEJGVKXUJH-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 89.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.05 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|