C34H39FN2O5Si — CID 175571992
tert-butyl N-[2-[tert-butyl(diphenyl)silyl]oxy-1-(8-fluoro-6-formyl-6,7-dihydro-5H-cyclopenta[f][1,3]benzoxazol-2-yl)ethyl]carbamate (PubChem CID 175571992) has the molecular formula C34H39FN2O5Si and a molecular weight of 602.78 g/mol. Its IUPAC name is tert-butyl N-[2-[tert-butyl(diphenyl)silyl]oxy-1-(8-fluoro-6-formyl-6,7-dihydro-5H-cyclopenta[f][1,3]benzoxazol-2-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[tert-butyl(diphenyl)silyl]oxy-1-(8-fluoro-6-formyl-6,7-dihydro-5H-cyclopenta[f][1,3]benzoxazol-2-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 175571992 |
| Molecular Formula | C34H39FN2O5Si |
| Molecular Weight | 602.78 g/mol |
| Exact Mass | 602.26 |
| IUPAC Name | tert-butyl N-[2-[tert-butyl(diphenyl)silyl]oxy-1-(8-fluoro-6-formyl-6,7-dihydro-5H-cyclopenta[f][1,3]benzoxazol-2-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(CO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)c1nc2cc3c(c(F)c2o1)CC(C=O)C3 |
| InChI | InChI=1S/C34H39FN2O5Si/c1-33(2,3)42-32(39)37-28(31-36-27-19-23-17-22(20-38)18-26(23)29(35)30(27)41-31)21-40-43(34(4,5)6,24-13-9-7-10-14-24)25-15-11-8-12-16-25/h7-16,19-20,22,28H,17-18,21H2,1-6H3,(H,37,39) |
| InChIKey | ZWSUZZXSEPECOT-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 90.66 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.78 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|