C17H21FN4O3 — CID 167514907
tert-butyl N-[2-(8-fluoro-6-formyl-6,7-dihydro-5H-cyclopenta[f]benzotriazol-1-yl)ethyl]carbamate (PubChem CID 167514907) has the molecular formula C17H21FN4O3 and a molecular weight of 348.38 g/mol. Its IUPAC name is tert-butyl N-[2-(8-fluoro-6-formyl-6,7-dihydro-5H-cyclopenta[f]benzotriazol-1-yl)ethyl]carbamate.
| Compound Name | tert-butyl N-[2-(8-fluoro-6-formyl-6,7-dihydro-5H-cyclopenta[f]benzotriazol-1-yl)ethyl]carbamate |
|---|---|
| PubChem CID | 167514907 |
| Molecular Formula | C17H21FN4O3 |
| Molecular Weight | 348.38 g/mol |
| Exact Mass | 348.16 |
| IUPAC Name | tert-butyl N-[2-(8-fluoro-6-formyl-6,7-dihydro-5H-cyclopenta[f]benzotriazol-1-yl)ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCn1nnc2cc3c(c(F)c21)CC(C=O)C3 |
| InChI | InChI=1S/C17H21FN4O3/c1-17(2,3)25-16(24)19-4-5-22-15-13(20-21-22)8-11-6-10(9-23)7-12(11)14(15)18/h8-10H,4-7H2,1-3H3,(H,19,24) |
| InChIKey | BEUUWWBPNBMTSD-UHFFFAOYSA-N |
| XLogP | 2.01 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.38 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|