C19H28N2O4 — CID 156862617
tert-butyl N-[3-[(6-formyl-1,4-dimethyl-6,7-dihydro-5H-cyclopenta[c]pyridin-3-yl)oxy]propyl]carbamate (PubChem CID 156862617) has the molecular formula C19H28N2O4 and a molecular weight of 348.44 g/mol. Its IUPAC name is tert-butyl N-[3-[(6-formyl-1,4-dimethyl-6,7-dihydro-5H-cyclopenta[c]pyridin-3-yl)oxy]propyl]carbamate.
| Compound Name | tert-butyl N-[3-[(6-formyl-1,4-dimethyl-6,7-dihydro-5H-cyclopenta[c]pyridin-3-yl)oxy]propyl]carbamate |
|---|---|
| PubChem CID | 156862617 |
| Molecular Formula | C19H28N2O4 |
| Molecular Weight | 348.44 g/mol |
| Exact Mass | 348.20 |
| IUPAC Name | tert-butyl N-[3-[(6-formyl-1,4-dimethyl-6,7-dihydro-5H-cyclopenta[c]pyridin-3-yl)oxy]propyl]carbamate |
| SMILES | Cc1nc(OCCCNC(=O)OC(C)(C)C)c(C)c2c1CC(C=O)C2 |
| InChI | InChI=1S/C19H28N2O4/c1-12-15-9-14(11-22)10-16(15)13(2)21-17(12)24-8-6-7-20-18(23)25-19(3,4)5/h11,14H,6-10H2,1-5H3,(H,20,23) |
| InChIKey | NUYDCVGXTBLPTM-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.44 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|