C19H35N3O4SSi — CID 175572805
2-[[4-[tert-butyl(dimethyl)silyl]oxy-5-morpholin-4-ylpentyl]amino]-1,3-thiazole-4-carboxylic acid (PubChem CID 175572805) has the molecular formula C19H35N3O4SSi and a molecular weight of 429.66 g/mol. Its IUPAC name is 2-[[4-[tert-butyl(dimethyl)silyl]oxy-5-morpholin-4-ylpentyl]amino]-1,3-thiazole-4-carboxylic acid.
| Compound Name | 2-[[4-[tert-butyl(dimethyl)silyl]oxy-5-morpholin-4-ylpentyl]amino]-1,3-thiazole-4-carboxylic acid |
|---|---|
| PubChem CID | 175572805 |
| Molecular Formula | C19H35N3O4SSi |
| Molecular Weight | 429.66 g/mol |
| Exact Mass | 429.21 |
| IUPAC Name | 2-[[4-[tert-butyl(dimethyl)silyl]oxy-5-morpholin-4-ylpentyl]amino]-1,3-thiazole-4-carboxylic acid |
| SMILES | CC(C)(C)[Si](C)(C)OC(CCCNc1nc(C(=O)O)cs1)CN1CCOCC1 |
| InChI | InChI=1S/C19H35N3O4SSi/c1-19(2,3)28(4,5)26-15(13-22-9-11-25-12-10-22)7-6-8-20-18-21-16(14-27-18)17(23)24/h14-15H,6-13H2,1-5H3,(H,20,21)(H,23,24) |
| InChIKey | PKISYCQEXQOYLJ-UHFFFAOYSA-N |
| XLogP | 3.76 |
| TPSA | 83.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.66 |
| LogP ≤ 5 | 3.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|