C21H22F2 — CID 175574830
5-ethyl-1,3-difluoro-2-[2-(2-pentylphenyl)ethynyl]benzene (PubChem CID 175574830) has the molecular formula C21H22F2 and a molecular weight of 312.40 g/mol. Its IUPAC name is 5-ethyl-1,3-difluoro-2-[2-(2-pentylphenyl)ethynyl]benzene.
| Compound Name | 5-ethyl-1,3-difluoro-2-[2-(2-pentylphenyl)ethynyl]benzene |
|---|---|
| PubChem CID | 175574830 |
| Molecular Formula | C21H22F2 |
| Molecular Weight | 312.40 g/mol |
| Exact Mass | 312.17 |
| IUPAC Name | 5-ethyl-1,3-difluoro-2-[2-(2-pentylphenyl)ethynyl]benzene |
| SMILES | CCCCCc1ccccc1C#Cc1c(F)cc(CC)cc1F |
| InChI | InChI=1S/C21H22F2/c1-3-5-6-9-17-10-7-8-11-18(17)12-13-19-20(22)14-16(4-2)15-21(19)23/h7-8,10-11,14-15H,3-6,9H2,1-2H3 |
| InChIKey | JREVFBZGOBWQKS-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.40 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|