C31H44N2O3Si — CID 175575330
tert-butyl 4-[1-[tert-butyl(diphenyl)silyl]carbonylcyclopropyl]-2,2-dimethylpiperazine-1-carboxylate (PubChem CID 175575330) has the molecular formula C31H44N2O3Si and a molecular weight of 520.79 g/mol. Its IUPAC name is tert-butyl 4-[1-[tert-butyl(diphenyl)silyl]carbonylcyclopropyl]-2,2-dimethylpiperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[1-[tert-butyl(diphenyl)silyl]carbonylcyclopropyl]-2,2-dimethylpiperazine-1-carboxylate |
|---|---|
| PubChem CID | 175575330 |
| Molecular Formula | C31H44N2O3Si |
| Molecular Weight | 520.79 g/mol |
| Exact Mass | 520.31 |
| IUPAC Name | tert-butyl 4-[1-[tert-butyl(diphenyl)silyl]carbonylcyclopropyl]-2,2-dimethylpiperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(C2(C(=O)[Si](c3ccccc3)(c3ccccc3)C(C)(C)C)CC2)CC1(C)C |
| InChI | InChI=1S/C31H44N2O3Si/c1-28(2,3)36-27(35)33-22-21-32(23-30(33,7)8)31(19-20-31)26(34)37(29(4,5)6,24-15-11-9-12-16-24)25-17-13-10-14-18-25/h9-18H,19-23H2,1-8H3 |
| InChIKey | VIYZJYYSNUOZJV-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.79 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|