C28H41N3O3SSi — CID 165376908
tert-butyl (2S)-2-[(E)-2-[[[tert-butyl(diphenyl)silyl]amino]sulfonimidoyl]ethenyl]-2-methylpyrrolidine-1-carboxylate (PubChem CID 165376908) has the molecular formula C28H41N3O3SSi and a molecular weight of 527.81 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(E)-2-[[[tert-butyl(diphenyl)silyl]amino]sulfonimidoyl]ethenyl]-2-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(E)-2-[[[tert-butyl(diphenyl)silyl]amino]sulfonimidoyl]ethenyl]-2-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 165376908 |
| Molecular Formula | C28H41N3O3SSi |
| Molecular Weight | 527.81 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | tert-butyl (2S)-2-[(E)-2-[[[tert-butyl(diphenyl)silyl]amino]sulfonimidoyl]ethenyl]-2-methylpyrrolidine-1-carboxylate |
| SMILES | [H]N=S(=O)(/C=C/[C@]1(C)CCCN1C(=O)OC(C)(C)C)N[Si](c1ccccc1)(c1ccccc1)C(C)(C)C |
| InChI | InChI=1S/C28H41N3O3SSi/c1-26(2,3)34-25(32)31-21-14-19-28(31,7)20-22-35(29,33)30-36(27(4,5)6,23-15-10-8-11-16-23)24-17-12-9-13-18-24/h8-13,15-18,20,22H,14,19,21H2,1-7H3,(H2,29,30,33)/b22-20+/t28-,35?/m0/s1 |
| InChIKey | JZEMMTXSSBSMKZ-OBUZLRSMSA-N |
| XLogP | 5.40 |
| TPSA | 82.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.81 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|