C41H54N4O4SSi — CID 165376916
tert-butyl (2S)-2-[(E)-2-[N-[tert-butyl(diphenyl)silyl]-S-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)sulfonimidoyl]ethenyl]-2-methylpyrrolidine-1-carboxylate (PubChem CID 165376916) has the molecular formula C41H54N4O4SSi and a molecular weight of 727.06 g/mol. Its IUPAC name is tert-butyl (2S)-2-[(E)-2-[N-[tert-butyl(diphenyl)silyl]-S-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)sulfonimidoyl]ethenyl]-2-methylpyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[(E)-2-[N-[tert-butyl(diphenyl)silyl]-S-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)sulfonimidoyl]ethenyl]-2-methylpyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 165376916 |
| Molecular Formula | C41H54N4O4SSi |
| Molecular Weight | 727.06 g/mol |
| Exact Mass | 726.36 |
| IUPAC Name | tert-butyl (2S)-2-[(E)-2-[N-[tert-butyl(diphenyl)silyl]-S-(1,2,3,5,6,7-hexahydro-s-indacen-4-ylcarbamoylamino)sulfonimidoyl]ethenyl]-2-methylpyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC[C@@]1(C)/C=C/S(=O)(=N[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)NC(=O)Nc1c2c(cc3c1CCC3)CCC2 |
| InChI | InChI=1S/C41H54N4O4SSi/c1-39(2,3)49-38(47)45-27-16-25-41(45,7)26-28-50(48,43-37(46)42-36-34-23-14-17-30(34)29-31-18-15-24-35(31)36)44-51(40(4,5)6,32-19-10-8-11-20-32)33-21-12-9-13-22-33/h8-13,19-22,26,28-29H,14-18,23-25,27H2,1-7H3,(H2,42,43,44,46,48)/b28-26+/t41-,50?/m0/s1 |
| InChIKey | BSOLXSCJTUBEMK-WLIMSJHGSA-N |
| XLogP | 8.03 |
| TPSA | 100.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 727.06 |
| LogP ≤ 5 | 8.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|