C17H24ClN3O4 — CID 175579373
2-chloro-3-nitro-N-[(2,2,4-trimethyl-1,3-dioxan-5-yl)methyl]-5,6,7,8-tetrahydroquinolin-4-amine (PubChem CID 175579373) has the molecular formula C17H24ClN3O4 and a molecular weight of 369.85 g/mol. Its IUPAC name is 2-chloro-3-nitro-N-[(2,2,4-trimethyl-1,3-dioxan-5-yl)methyl]-5,6,7,8-tetrahydroquinolin-4-amine.
| Compound Name | 2-chloro-3-nitro-N-[(2,2,4-trimethyl-1,3-dioxan-5-yl)methyl]-5,6,7,8-tetrahydroquinolin-4-amine |
|---|---|
| PubChem CID | 175579373 |
| Molecular Formula | C17H24ClN3O4 |
| Molecular Weight | 369.85 g/mol |
| Exact Mass | 369.15 |
| IUPAC Name | 2-chloro-3-nitro-N-[(2,2,4-trimethyl-1,3-dioxan-5-yl)methyl]-5,6,7,8-tetrahydroquinolin-4-amine |
| SMILES | CC1OC(C)(C)OCC1CNc1c2c(nc(Cl)c1[N+](=O)[O-])CCCC2 |
| InChI | InChI=1S/C17H24ClN3O4/c1-10-11(9-24-17(2,3)25-10)8-19-14-12-6-4-5-7-13(12)20-16(18)15(14)21(22)23/h10-11H,4-9H2,1-3H3,(H,19,20) |
| InChIKey | XCKRADCATBPODI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 86.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.85 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|