C19H20F3N5O — CID 175596343
2-[(2S)-1,2,3,4-tetrahydroquinolin-2-yl]-4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carbaldehyde (PubChem CID 175596343) has the molecular formula C19H20F3N5O and a molecular weight of 391.40 g/mol. Its IUPAC name is 2-[(2S)-1,2,3,4-tetrahydroquinolin-2-yl]-4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carbaldehyde.
| Compound Name | 2-[(2S)-1,2,3,4-tetrahydroquinolin-2-yl]-4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carbaldehyde |
|---|---|
| PubChem CID | 175596343 |
| Molecular Formula | C19H20F3N5O |
| Molecular Weight | 391.40 g/mol |
| Exact Mass | 391.16 |
| IUPAC Name | 2-[(2S)-1,2,3,4-tetrahydroquinolin-2-yl]-4-[5-(trifluoromethyl)pyrimidin-2-yl]piperazine-1-carbaldehyde |
| SMILES | O=CN1CCN(c2ncc(C(F)(F)F)cn2)CC1[C@@H]1CCc2ccccc2N1 |
| InChI | InChI=1S/C19H20F3N5O/c20-19(21,22)14-9-23-18(24-10-14)26-7-8-27(12-28)17(11-26)16-6-5-13-3-1-2-4-15(13)25-16/h1-4,9-10,12,16-17,25H,5-8,11H2/t16-,17?/m0/s1 |
| InChIKey | ILOMMLOQHQIMHU-BHWOMJMDSA-N |
| XLogP | 2.57 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.40 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|