C15H26FN — CID 175612307
(4Z)-4-[(2-fluoro-2-methylcyclopropyl)methylidene]-1,2-di(propan-2-yl)pyrrolidine (PubChem CID 175612307) has the molecular formula C15H26FN and a molecular weight of 239.38 g/mol. Its IUPAC name is (4Z)-4-[(2-fluoro-2-methylcyclopropyl)methylidene]-1,2-di(propan-2-yl)pyrrolidine.
| Compound Name | (4Z)-4-[(2-fluoro-2-methylcyclopropyl)methylidene]-1,2-di(propan-2-yl)pyrrolidine |
|---|---|
| PubChem CID | 175612307 |
| Molecular Formula | C15H26FN |
| Molecular Weight | 239.38 g/mol |
| Exact Mass | 239.20 |
| IUPAC Name | (4Z)-4-[(2-fluoro-2-methylcyclopropyl)methylidene]-1,2-di(propan-2-yl)pyrrolidine |
| SMILES | CC(C)C1C/C(=C/C2CC2(C)F)CN1C(C)C |
| InChI | InChI=1S/C15H26FN/c1-10(2)14-7-12(9-17(14)11(3)4)6-13-8-15(13,5)16/h6,10-11,13-14H,7-9H2,1-5H3/b12-6- |
| InChIKey | BDESITNEGMVZTN-SDQBBNPISA-N |
| XLogP | 3.80 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.38 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|