C24H26BN7O — CID 175613289
CID 175613289 (PubChem CID 175613289) has the molecular formula C24H26BN7O and a molecular weight of 439.33 g/mol.
| Compound Name | CID 175613289 |
|---|---|
| PubChem CID | 175613289 |
| Molecular Formula | C24H26BN7O |
| Molecular Weight | 439.33 g/mol |
| Exact Mass | 439.23 |
| IUPAC Name | — |
| SMILES | [B]c1cnc(NC)c2ncc(N3CCN(Cc4cnc5cc(CC)c(=O)[nH]c5c4)CC3)cc12 |
| InChI | InChI=1S/C24H26BN7O/c1-3-16-9-20-21(30-24(16)33)8-15(11-27-20)14-31-4-6-32(7-5-31)17-10-18-19(25)13-29-23(26-2)22(18)28-12-17/h8-13H,3-7,14H2,1-2H3,(H,26,29)(H,30,33) |
| InChIKey | CFFSXNAGHLHUMO-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 90.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.33 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|