C29H32N2O2P+ — CID 175638111
2-ethoxy-6,17,18-trimethyl-12-(2-methylphenyl)-18-aza-6-azonia-2λ5-phosphapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3,5,9,11,14,19-heptaene 2-oxide (PubChem CID 175638111) has the molecular formula C29H32N2O2P+ and a molecular weight of 471.56 g/mol. Its IUPAC name is 2-ethoxy-6,17,18-trimethyl-12-(2-methylphenyl)-18-aza-6-azonia-2λ5-phosphapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3,5,9,11,14,19-heptaene 2-oxide.
| Compound Name | 2-ethoxy-6,17,18-trimethyl-12-(2-methylphenyl)-18-aza-6-azonia-2λ5-phosphapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3,5,9,11,14,19-heptaene 2-oxide |
|---|---|
| PubChem CID | 175638111 |
| Molecular Formula | C29H32N2O2P+ |
| Molecular Weight | 471.56 g/mol |
| Exact Mass | 471.22 |
| IUPAC Name | 2-ethoxy-6,17,18-trimethyl-12-(2-methylphenyl)-18-aza-6-azonia-2λ5-phosphapentacyclo[11.7.0.03,11.05,9.015,19]icosa-1(13),3,5,9,11,14,19-heptaene 2-oxide |
| SMILES | CCOP1(=O)c2cc3c(cc2C(c2ccccc2C)=c2cc4c(cc21)=[N+](C)CC4)CC(C)N3C |
| InChI | InChI=1S/C29H32N2O2P/c1-6-33-34(32)27-16-25-20(11-12-30(25)4)14-23(27)29(22-10-8-7-9-18(22)2)24-15-21-13-19(3)31(5)26(21)17-28(24)34/h7-10,14-17,19H,6,11-13H2,1-5H3/q+1 |
| InChIKey | ATFRVXWYJFYIAW-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 32.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.56 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|