C22H28O8 — CID 175639731
2-[2-[[6-[2-(3,4,5-trimethoxyphenyl)ethyl]-1,3-benzodioxol-4-yl]oxy]ethoxy]ethanol (PubChem CID 175639731) has the molecular formula C22H28O8 and a molecular weight of 420.46 g/mol. Its IUPAC name is 2-[2-[[6-[2-(3,4,5-trimethoxyphenyl)ethyl]-1,3-benzodioxol-4-yl]oxy]ethoxy]ethanol.
| Compound Name | 2-[2-[[6-[2-(3,4,5-trimethoxyphenyl)ethyl]-1,3-benzodioxol-4-yl]oxy]ethoxy]ethanol |
|---|---|
| PubChem CID | 175639731 |
| Molecular Formula | C22H28O8 |
| Molecular Weight | 420.46 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 2-[2-[[6-[2-(3,4,5-trimethoxyphenyl)ethyl]-1,3-benzodioxol-4-yl]oxy]ethoxy]ethanol |
| SMILES | COc1cc(CCc2cc(OCCOCCO)c3c(c2)OCO3)cc(OC)c1OC |
| InChI | InChI=1S/C22H28O8/c1-24-17-10-15(11-18(25-2)21(17)26-3)4-5-16-12-19(28-9-8-27-7-6-23)22-20(13-16)29-14-30-22/h10-13,23H,4-9,14H2,1-3H3 |
| InChIKey | HDFXNCMBGSXKSE-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 84.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.46 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|