C14H14N2O3S2 — CID 175647305
4-methylbenzenesulfonate;thieno[2,3-b]pyridin-7-ium-3-amine (PubChem CID 175647305) has the molecular formula C14H14N2O3S2 and a molecular weight of 322.41 g/mol. Its IUPAC name is 4-methylbenzenesulfonate;thieno[2,3-b]pyridin-7-ium-3-amine.
| Compound Name | 4-methylbenzenesulfonate;thieno[2,3-b]pyridin-7-ium-3-amine |
|---|---|
| PubChem CID | 175647305 |
| Molecular Formula | C14H14N2O3S2 |
| Molecular Weight | 322.41 g/mol |
| Exact Mass | 322.04 |
| IUPAC Name | 4-methylbenzenesulfonate;thieno[2,3-b]pyridin-7-ium-3-amine |
| SMILES | Cc1ccc(S(=O)(=O)[O-])cc1.Nc1csc2[nH+]cccc12 |
| InChI | InChI=1S/C7H6N2S.C7H8O3S/c8-6-4-10-7-5(6)2-1-3-9-7;1-6-2-4-7(5-3-6)11(8,9)10/h1-4H,8H2;2-5H,1H3,(H,8,9,10) |
| InChIKey | NFCHBNNOIOCVGA-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.41 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|