C23H21F3N4O2 — CID 175665064
6-[4-(dimethylamino)phenyl]-1,3-dimethyl-5-[4-(trifluoromethyl)phenyl]pyrrolo[3,2-d]pyrimidine-2,4-dione (PubChem CID 175665064) has the molecular formula C23H21F3N4O2 and a molecular weight of 442.44 g/mol. Its IUPAC name is 6-[4-(dimethylamino)phenyl]-1,3-dimethyl-5-[4-(trifluoromethyl)phenyl]pyrrolo[3,2-d]pyrimidine-2,4-dione.
| Compound Name | 6-[4-(dimethylamino)phenyl]-1,3-dimethyl-5-[4-(trifluoromethyl)phenyl]pyrrolo[3,2-d]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 175665064 |
| Molecular Formula | C23H21F3N4O2 |
| Molecular Weight | 442.44 g/mol |
| Exact Mass | 442.16 |
| IUPAC Name | 6-[4-(dimethylamino)phenyl]-1,3-dimethyl-5-[4-(trifluoromethyl)phenyl]pyrrolo[3,2-d]pyrimidine-2,4-dione |
| SMILES | CN(C)c1ccc(-c2cc3c(c(=O)n(C)c(=O)n3C)n2-c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C23H21F3N4O2/c1-27(2)16-9-5-14(6-10-16)18-13-19-20(21(31)29(4)22(32)28(19)3)30(18)17-11-7-15(8-12-17)23(24,25)26/h5-13H,1-4H3 |
| InChIKey | NYCQFOISZKNFBI-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 52.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.44 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_G(9)', 'substructure': 'N/A'} |
|---|