C19H26ClN5O6P2 — CID 175665106
[5-[6-[benzyl(methyl)amino]-2-chloropurin-9-yl]pentoxy-hydroxyphosphoryl]methylphosphonic acid (PubChem CID 175665106) has the molecular formula C19H26ClN5O6P2 and a molecular weight of 517.85 g/mol. Its IUPAC name is [5-[6-[benzyl(methyl)amino]-2-chloropurin-9-yl]pentoxy-hydroxyphosphoryl]methylphosphonic acid.
| Compound Name | [5-[6-[benzyl(methyl)amino]-2-chloropurin-9-yl]pentoxy-hydroxyphosphoryl]methylphosphonic acid |
|---|---|
| PubChem CID | 175665106 |
| Molecular Formula | C19H26ClN5O6P2 |
| Molecular Weight | 517.85 g/mol |
| Exact Mass | 517.10 |
| IUPAC Name | [5-[6-[benzyl(methyl)amino]-2-chloropurin-9-yl]pentoxy-hydroxyphosphoryl]methylphosphonic acid |
| SMILES | CN(Cc1ccccc1)c1nc(Cl)nc2c1ncn2CCCCCOP(=O)(O)CP(=O)(O)O |
| InChI | InChI=1S/C19H26ClN5O6P2/c1-24(12-15-8-4-2-5-9-15)17-16-18(23-19(20)22-17)25(13-21-16)10-6-3-7-11-31-33(29,30)14-32(26,27)28/h2,4-5,8-9,13H,3,6-7,10-12,14H2,1H3,(H,29,30)(H2,26,27,28) |
| InChIKey | OLMZSRUZLJBCCU-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 150.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.85 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|