C12H13NS — CID 175666416
3,4,5,5a-tetrahydro-2H-thiepino[2,3-b]indole (PubChem CID 175666416) has the molecular formula C12H13NS and a molecular weight of 203.31 g/mol. Its IUPAC name is 3,4,5,5a-tetrahydro-2H-thiepino[2,3-b]indole.
| Compound Name | 3,4,5,5a-tetrahydro-2H-thiepino[2,3-b]indole |
|---|---|
| PubChem CID | 175666416 |
| Molecular Formula | C12H13NS |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.08 |
| IUPAC Name | 3,4,5,5a-tetrahydro-2H-thiepino[2,3-b]indole |
| SMILES | c1ccc2c(c1)N=C1SCCCCC12 |
| InChI | InChI=1S/C12H13NS/c1-2-7-11-9(5-1)10-6-3-4-8-14-12(10)13-11/h1-2,5,7,10H,3-4,6,8H2 |
| InChIKey | OPSQRHVRGUYJSZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |