C31H36Cl2N2O5S — CID 175675045
ethyl (Z)-3-[2,6-dichloro-4-[[4-[3-[(1S)-1-hexoxyethyl]-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoate (PubChem CID 175675045) has the molecular formula C31H36Cl2N2O5S and a molecular weight of 619.61 g/mol. Its IUPAC name is ethyl (Z)-3-[2,6-dichloro-4-[[4-[3-[(1S)-1-hexoxyethyl]-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoate.
| Compound Name | ethyl (Z)-3-[2,6-dichloro-4-[[4-[3-[(1S)-1-hexoxyethyl]-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoate |
|---|---|
| PubChem CID | 175675045 |
| Molecular Formula | C31H36Cl2N2O5S |
| Molecular Weight | 619.61 g/mol |
| Exact Mass | 618.17 |
| IUPAC Name | ethyl (Z)-3-[2,6-dichloro-4-[[4-[3-[(1S)-1-hexoxyethyl]-2-methoxyphenyl]-1,3-thiazol-2-yl]carbamoyl]phenyl]-2-methylprop-2-enoate |
| SMILES | CCCCCCO[C@@H](C)c1cccc(-c2csc(NC(=O)c3cc(Cl)c(/C=C(/C)C(=O)OCC)c(Cl)c3)n2)c1OC |
| InChI | InChI=1S/C31H36Cl2N2O5S/c1-6-8-9-10-14-40-20(4)22-12-11-13-23(28(22)38-5)27-18-41-31(34-27)35-29(36)21-16-25(32)24(26(33)17-21)15-19(3)30(37)39-7-2/h11-13,15-18,20H,6-10,14H2,1-5H3,(H,34,35,36)/b19-15-/t20-/m0/s1 |
| InChIKey | FDMQKVKNJMQEGF-YKRMCXMESA-N |
| XLogP | 9.00 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 619.61 |
| LogP ≤ 5 | 9.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|